mindquantum.core.gates.channel 源代码

# Copyright 2021 Huawei Technologies Co., Ltd
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ============================================================================

# pylint: disable=abstract-method,no-member
"""Quantum channel."""

from itertools import product
from math import exp, sqrt

import numpy as np
import numpy.typing as npt

from mindquantum import mqbackend as mb
from mindquantum.utils.f import _check_input_type, _check_num_array
from mindquantum.utils.string_utils import string_expression

from .basic import BasicGate, NoiseGate, NonHermitianGate, SelfHermitianGate


[文档] class GroupedPauliChannel(NoiseGate, SelfHermitianGate): r""" A group of pauli channels. This quantum channel is equivalent to a list of pauli channels, but will evaluate much faster than apply them one by one. For detail of pauli channel, please refers to :class:`~.core.gates.PauliChannel`. .. math:: \epsilon(\rho) = \otimes_i \epsilon_\text{pauli}^i(\rho) Args: probs (numpy.ndarray): The error probabilities of pauli channel. It has dimension of `(n, 3)`, where the first dimension `n` is the qubit number or the number of pauli channels represented by this quantum channel . The second dimension `3` represents the probability of applying :math:`X`, :math:`Y` or :math:`Z` gate. Examples: >>> import numpy as np >>> from mindquantum.core.gates import GroupedPauliChannel >>> from mindquantum.core.circuit import Circuit >>> from mindquantum.simulator import Simulator >>> probs = np.array([[1.0, 0.0, 0.0], [0.0, 0.3, 0.0]]) >>> circ = Circuit([GroupedPauliChannel(probs).on([0, 1])]).measure_all() >>> circ ╭ ╔═══Grouped Pauli Channel ╮ ┍━━━━━━┑ q0: ──┤─╢ PC(px=1, py=0, pz=0) ╟──────├─┤ M q0 ├─── │ ╚══════════════════════╝ │ ┕━━━━━━┙ │ ╔═════════════════════════╗ │ ┍━━━━━━┑ q1: ──┤─╢ PC(px=0, py=3/10, pz=0) ╟───├─┤ M q1 ├─── ╰ ╚═════════════════════════╝ ╯ ┕━━━━━━┙ >>> Simulator('mqvector', circ.n_qubits).sampling(circ, shots=1000, seed=42) shots: 1000 Keys: q1 q0│0.00 0.177 0.355 0.532 0.71 0.887 ───────────┼───────────┴───────────┴───────────┴───────────┴───────────┴ 01│▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓ │ 11│▒▒▒▒▒▒▒▒▒▒▒▒▒▒▒▒▒▒▒▒ │ {'01': 710, '11': 290} """ def __init__(self, probs: npt.NDArray[np.float64], **kwargs): """Initialize a GroupedPauliChannel object.""" if 'name' not in kwargs: kwargs['name'] = 'GPC' kwargs['n_qubits'] = probs.shape[0] _check_input_type("probs", np.ndarray, probs) if not np.issubdtype(probs.dtype, np.floating): raise TypeError(f"probs requires a real number type, but get {probs.dtype}") if np.any(probs < 0.0): raise ValueError("probs cannot be negative value.") shape = probs.shape if len(shape) != 2: raise ValueError(f"probs requires a two dimension array, but get dimension with {shape}") if shape[1] != 3: raise ValueError(f"The second dimension of probs should be two, but get {shape[1]}") wrong_channel = np.where(probs.sum(axis=1) > 1)[0] if wrong_channel.shape[0]: raise ValueError(f"Wrong probs for {wrong_channel[0]}-pauli channel: {probs[wrong_channel[0]]}") self.probs = probs NoiseGate.__init__(self, **kwargs) SelfHermitianGate.__init__(self, **kwargs) def __eq__(self, other): """Equality comparison operator.""" if isinstance(other, GroupedPauliChannel): return BasicGate.__eq__(self, other) and np.allclose(self.probs, other.probs, atol=1e-8) return False
[文档] def get_cpp_obj(self): """Get underlying C++ object.""" return mb.gate.GroupedPauliChannel(self.probs, self.obj_qubits, self.ctrl_qubits)
[文档] def matrix(self): # pylint: disable=arguments-differ """ Kraus operator of the quantum channel. Returns: list, contains all Kraus operators of every pauli channel. """ mat = [] for prob in self.probs: px, py, pz = prob mat_i = sqrt(1 - px - py - pz) * np.array([[1, 0], [0, 1]]) mat_x = sqrt(px) * np.array([[0, 1], [1, 0]]) mat_y = sqrt(py) * np.array([[0, -1j], [1j, 0]]) mat_z = sqrt(pz) * np.array([[1, 0], [0, -1]]) mat.append([mat_i, mat_x, mat_y, mat_z]) return mat
[文档] class PauliChannel(NoiseGate, SelfHermitianGate): r""" A pauli channel. Pauli channel express error that randomly applies an additional :math:`X`, :math:`Y` or :math:`Z` gate on qubits with different probabilities :math:`P_x`, :math:`P_y` and :math:`P_z`, or do noting (applies :math:`I` gate) with probability :math:`1-P_x-P_y-P_z`. Pauli channel applies noise as: .. math:: \epsilon(\rho) = (1 - P_x - P_y - P_z)\rho + P_x X \rho X + P_y Y \rho Y + P_z Z \rho Z where :math:`\rho` is quantum state as density matrix type; :math:`P_x`, :math:`P_y` and :math:`P_z` is the probability of applying an additional :math:`X`, :math:`Y` and :math:`Z` gate. Args: px (int, float): probability of applying X gate. py (int, float): probability of applying Y gate. pz (int, float): probability of applying Z gate. Examples: >>> from mindquantum.core.gates import PauliChannel >>> from mindquantum.core.circuit import Circuit >>> circ = Circuit() >>> circ += PauliChannel(0.8, 0.1, 0.1).on(0) >>> circ.measure_all() >>> print(circ) ╔══════════════════════════════╗ ┍━━━━━━┑ q0: ──╢ PC(px=4/5, py=1/10, pz=1/10) ╟─┤ M q0 ├─── ╚══════════════════════════════╝ ┕━━━━━━┙ >>> from mindquantum.simulator import Simulator >>> sim = Simulator('mqvector', 1) >>> sim.sampling(circ, shots=1000, seed=42) shots: 1000 Keys: q0│0.00 0.2 0.4 0.6 0.8 1.0 ────────┼───────────┴───────────┴───────────┴───────────┴───────────┴ 0│▒▒▒▒▒▒▒ │ 1│▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓ │ {'0': 101, '1': 899} """ def __init__(self, px: float, py: float, pz: float, **kwargs): """Initialize a PauliChannel object.""" # pylint: disable=invalid-name if 'name' not in kwargs: kwargs['name'] = 'PC' kwargs['n_qubits'] = 1 NoiseGate.__init__(self, **kwargs) SelfHermitianGate.__init__(self, **kwargs) self.projectq_gate = None if not isinstance(px, (int, float)): raise TypeError(f"Unsupported type for px, get {type(px)}.") if not isinstance(py, (int, float)): raise TypeError(f"Unsupported type for py, get {type(py)}.") if not isinstance(pz, (int, float)): raise TypeError(f"Unsupported type for pz, get {type(pz)}.") if np.any(np.array([px, py, pz]) < 0.0): raise ValueError("Probability cannot be negative value.") if 0 <= px + py + pz <= 1: self.px = float(px) self.py = float(py) self.pz = float(pz) else: raise ValueError("Required total probability P = px + py + pz ∈ [0,1].") def __extra_prop__(self): """Extra prop magic method.""" return {'px': self.px, 'py': self.py, 'pz': self.pz} def __type_specific_str__(self): """Return a string representation of the object.""" return f'px={string_expression(self.px)}, py={string_expression(self.py)}, pz={string_expression(self.pz)}'
[文档] def get_cpp_obj(self): """Get underlying C++ object.""" return mb.gate.PauliChannel(self.px, self.py, self.pz, self.obj_qubits, self.ctrl_qubits)
[文档] def define_projectq_gate(self): """Define the corresponded projectq gate.""" self.projectq_gate = None
def __eq__(self, other): """Equality comparison operator.""" if isinstance(other, PauliChannel): if BasicGate.__eq__(self, other) and self.px == other.px and self.py == other.py and self.pz == other.pz: return True return False
[文档] def matrix(self): # pylint: disable=arguments-differ """ Kraus operator of the quantum channel. Returns: list, contains all Kraus operators of this quantum channel. """ mat_i = sqrt(1 - self.px - self.py - self.pz) * np.array([[1, 0], [0, 1]]) mat_x = sqrt(self.px) * np.array([[0, 1], [1, 0]]) mat_y = sqrt(self.py) * np.array([[0, -1j], [1j, 0]]) mat_z = sqrt(self.pz) * np.array([[1, 0], [0, -1]]) return [mat_i, mat_x, mat_y, mat_z]
[文档] class BitFlipChannel(PauliChannel): r""" A bit flip channel. Bit flip channel express error that randomly flip the qubit (applies :math:`X` gate) with probability :math:`P`, or do noting (applies :math:`I` gate) with probability :math:`1-P`. Bit flip channel applies noise as: .. math:: \epsilon(\rho) = (1 - P)\rho + P X \rho X where :math:`\rho` is quantum state as density matrix type; :math:`P` is the probability of applying an additional :math:`X` gate. Args: p (int, float): probability of occurred error. Examples: >>> from mindquantum.core.gates import BitFlipChannel >>> from mindquantum.core.circuit import Circuit >>> circ = Circuit() >>> circ += BitFlipChannel(0.02).on(0) >>> print(circ) ╔═════════════╗ q0: ──╢ BFC(p=1/50) ╟─── ╚═════════════╝ """ # pylint: disable=invalid-name def __init__(self, p: float, **kwargs): """Initialize a BitFlipChannel object.""" kwargs['name'] = 'BFC' kwargs['n_qubits'] = 1 kwargs['px'] = p kwargs['py'] = 0 kwargs['pz'] = 0 PauliChannel.__init__(self, **kwargs) self.p = p def __extra_prop__(self): """Extra prop magic method.""" prop = super().__extra_prop__() prop['p'] = self.p return prop def __type_specific_str__(self): """Return a string representation of the object.""" return f'p={string_expression(self.p)}'
[文档] def matrix(self): """ Kraus operator of the quantum channel. Returns: list, contains all Kraus operators of this quantum channel. """ mat_i = sqrt(1 - self.p) * np.array([[1, 0], [0, 1]]) mat_x = sqrt(self.p) * np.array([[0, 1], [1, 0]]) return [mat_i, mat_x]
[文档] class PhaseFlipChannel(PauliChannel): r""" A phase flip channel. Phase flip channel express error that randomly flip the phase of qubit (applies Z gate) with probability :math:`P`, or do noting (applies I gate) with probability :math:`1-P`. Phase flip channel applies noise as: .. math:: \epsilon(\rho) = (1 - P)\rho + P Z \rho Z where :math:`\rho` is quantum state as density matrix type; :math:`P` is the probability of applying an additional Z gate. Args: p (int, float): probability of occurred error. Examples: >>> from mindquantum.core.gates import PhaseFlipChannel >>> from mindquantum.core.circuit import Circuit >>> circ = Circuit() >>> circ += PhaseFlipChannel(0.02).on(0) >>> print(circ) ╔═════════════╗ q0: ──╢ PFC(p=1/50) ╟─── ╚═════════════╝ """ # pylint: disable=invalid-name def __init__(self, p: float, **kwargs): """Initialize a PhaseFlipChannel object.""" kwargs['name'] = 'PFC' kwargs['n_qubits'] = 1 kwargs['px'] = 0 kwargs['py'] = 0 kwargs['pz'] = p PauliChannel.__init__(self, **kwargs) self.p = p def __extra_prop__(self): """Extra prop magic method.""" prop = super().__extra_prop__() prop['p'] = self.p return prop def __type_specific_str__(self): """Return a string representation of the object.""" return f'p={string_expression(self.p)}'
[文档] def matrix(self): """ Kraus operator of the quantum channel. Returns: list, contains all Kraus operators of this quantum channel. """ mat_i = sqrt(1 - self.p) * np.array([[1, 0], [0, 1]]) mat_z = sqrt(self.p) * np.array([[1, 0], [0, -1]]) return [mat_i, mat_z]
[文档] class BitPhaseFlipChannel(PauliChannel): r""" A bit&phase flip channel. Bit phase flip channel express error that randomly flip both the state and phase of qubit (applies :math:`Y` gate) with probability :math:`P`, or do noting (applies :math:`I` gate) with probability :math:`1-P`. Bit phase flip channel applies noise as: .. math:: \epsilon(\rho) = (1 - P)\rho + P Y \rho Y where :math:`\rho` is quantum state as density matrix type; :math:`P` is the probability of applying an additional :math:`Y` gate. Args: p (int, float): probability of occurred error. Examples: >>> from mindquantum.core.gates import BitPhaseFlipChannel >>> from mindquantum.core.circuit import Circuit >>> circ = Circuit() >>> circ += BitPhaseFlipChannel(0.02).on(0) >>> print(circ) ╔══════════════╗ q0: ──╢ BPFC(p=1/50) ╟─── ╚══════════════╝ """ # pylint: disable=invalid-name def __init__(self, p: float, **kwargs): """Initialize a BitPhaseFlipChannel object.""" kwargs['name'] = 'BPFC' kwargs['n_qubits'] = 1 kwargs['px'] = 0 kwargs['py'] = p kwargs['pz'] = 0 PauliChannel.__init__(self, **kwargs) self.p = p def __extra_prop__(self): """Extra prop magic method.""" prop = super().__extra_prop__() prop['p'] = self.p return prop def __type_specific_str__(self): """Return a string representation of the object.""" return f'p={string_expression(self.p)}'
[文档] def matrix(self): """ Kraus operator of the quantum channel. Returns: list, contains all Kraus operators of this quantum channel. """ mat_i = sqrt(1 - self.p) * np.array([[1, 0], [0, 1]]) mat_y = sqrt(self.p) * np.array([[0, -1j], [1j, 0]]) return [mat_i, mat_y]
[文档] class DepolarizingChannel(NoiseGate, SelfHermitianGate): r""" A depolarizing channel. Depolarizing channel express errors that have probability :math:`P` to turn qubit's quantum state into maximally mixed state, by randomly applying one of the pauli gate(I,X,Y,Z) with same probability :math:`P/4`. And it has probability :math:`1-P` to change nothing. In one qubit case, depolarizing channel applies noise as: .. math:: \epsilon(\rho) = (1 - P)\rho + P/4( I \rho I + X \rho X + Y \rho Y + Z \rho Z) where :math:`\rho` is quantum state as density matrix type; :math:`P` is the probability of occurred the depolarizing error. This channel supports many object qubits. In :math:`N` qubit case, depolarizing channel applies noise as: .. math:: \epsilon(\rho) = (1 - P)\rho + \frac{P}{4^N} \sum_j U_j \rho U_j where :math:`N` is the number of object qubits; :math:`U_j \in \left\{ I, X, Y, Z \right\} ^{\otimes N}` is many qubit pauli operator. * For :math:`0 \le P \le 1` case, this channel is a depolarizing channel, and it becomes a completely depolarizing channel when :math:`P = 1`. * However, :math:`1 < P \le 4^N / (4^N - 1)` is also an available case, but not a depolarizing channel any more. When :math:`P = 4^N / (4^N - 1)` it becomes a uniform Pauli error channel: :math:`E(\rho) = \sum_j V_j \rho V_j / (4^n - 1)`, where :math:`V_j = U_j \setminus I^{\otimes N}`. Args: p (int, float): probability of occurred depolarizing error. n_qubits (int): qubit number of this depolarizing channel. Default: ``1``. Examples: >>> from mindquantum.core.gates import DepolarizingChannel >>> from mindquantum.core.circuit import Circuit >>> circ = Circuit() >>> circ += DepolarizingChannel(0.02).on(0) >>> circ += DepolarizingChannel(0.01, 2).on([0, 1]) >>> print(circ) ╔════════════╗ ╔═════════════╗ q0: ──╢ DC(p=1/50) ╟─╢ ╟─── ╚════════════╝ ║ ║ ║ DC(p=1/100) ║ q1: ─────────────────╢ ╟─── ╚═════════════╝ """ # pylint: disable=invalid-name def __init__(self, p: float, n_qubits: int = 1, **kwargs): """Initialize a DepolarizingChannel object.""" kwargs['name'] = 'DC' kwargs['n_qubits'] = n_qubits NoiseGate.__init__(self, **kwargs) SelfHermitianGate.__init__(self, **kwargs) self.projectq_gate = None if not isinstance(p, (int, float)): raise TypeError(f"Unsupported type for argument p, get {type(p)}.") self.p = p if not 0 <= self.p <= 4**self.n_qubits / (4**self.n_qubits - 1): raise ValueError( f"Required argument p ∈ [0, {4**self.n_qubits}/{4**self.n_qubits - 1}], but get p = {self.p}." )
[文档] def get_cpp_obj(self): """Get underlying C++ object.""" return mb.gate.DepolarizingChannel(self.p, self.obj_qubits, self.ctrl_qubits)
def __eq__(self, other): """Equality comparison operator.""" return super().__eq__(other) and self.p == other.p def __extra_prop__(self): """Extra prop magic method.""" return {'p': self.p} def __type_specific_str__(self): """Return a string representation of the object.""" return f'p={string_expression(self.p)}'
[文档] def matrix(self): # pylint: disable=arguments-differ r""" Kraus operator of the quantum channel. Returns: list, the kraus matrix of this operator, while order of output is in dictionary order of :math:`\left\{ I, X, Y, Z \right\} ^{\otimes N}`. """ # pylint: disable=import-outside-toplevel from mindquantum.core.operators import QubitOperator p = np.ones(4**self.n_qubits) * sqrt(self.p) / 2**self.n_qubits p[0] = sqrt(1 - self.p + self.p / 4**self.n_qubits) out = [] for i_pauli, pauli_tuple in enumerate(product(['I', 'X', 'Y', 'Z'], repeat=self.n_qubits)): pauli_string = ' '.join(f"{pauli}{idx}" for idx, pauli in enumerate(pauli_tuple) if pauli != 'I') m = QubitOperator(pauli_string).matrix(self.n_qubits) * p[i_pauli] out.append(m.toarray()) return out
[文档] class AmplitudeDampingChannel(NoiseGate, NonHermitianGate): r""" Amplitude damping channel express error that qubit is affected by the energy dissipation. Amplitude damping channel applies noise as: .. math:: \begin{gather*} \epsilon(\rho) = E_0 \rho E_0^\dagger + E_1 \rho E_1^\dagger \\ \text{where}\ {E_0}=\begin{bmatrix}1&0\\ 0&\sqrt{1-\gamma}\end{bmatrix}, \ {E_1}=\begin{bmatrix}0&\sqrt{\gamma}\\ 0&0\end{bmatrix} \end{gather*} where :math:`\rho` is quantum state as density matrix type; :math:`\gamma` is the coefficient of energy dissipation. Args: gamma (int, float): damping coefficient. Examples: >>> from mindquantum.core.gates import AmplitudeDampingChannel >>> from mindquantum.core.circuit import Circuit >>> circ = Circuit() >>> circ += AmplitudeDampingChannel(0.02).on(0) >>> print(circ) ╔═════════════╗ q0: ──╢ ADC(γ=1/50) ╟─── ╚═════════════╝ """ def __init__(self, gamma: float, **kwargs): """Initialize an AmplitudeDampingChannel object.""" kwargs['name'] = 'ADC' kwargs['n_qubits'] = 1 NoiseGate.__init__(self, **kwargs) NonHermitianGate.__init__(self, **kwargs) self.projectq_gate = None if not isinstance(gamma, (int, float)): raise TypeError(f"Unsupported type for gamma, get {type(gamma)}.") if 0 <= gamma <= 1: self.gamma = gamma else: raise ValueError("Required damping coefficient gamma ∈ [0,1].") def __eq__(self, other): """Equality comparison operator.""" return BasicGate.__eq__(self, other) and self.gamma == other.gamma def __type_specific_str__(self): """Return a string representation of the object.""" return f'γ={string_expression(self.gamma)}'
[文档] def get_cpp_obj(self): """Get underlying C++ object.""" return mb.gate.AmplitudeDampingChannel(self.hermitianed, self.gamma, self.obj_qubits, self.ctrl_qubits)
[文档] def define_projectq_gate(self): """Define the corresponded projectq gate.""" self.projectq_gate = None
[文档] def matrix(self): # pylint: disable=arguments-differ """ Kraus operator of the quantum channel. Returns: list, contains all Kraus operators of this quantum channel. """ mat_0 = np.array([[1, 0], [0, sqrt(1 - self.gamma)]]) mat_1 = np.array([[0, sqrt(self.gamma)], [0, 0]]) if self.hermitianed: return np.array([mat_0, mat_1.T]) return [mat_0, mat_1]
[文档] class PhaseDampingChannel(NoiseGate, NonHermitianGate): r""" A phase damping channel. Phase damping channel express error that qubit loses quantum information without exchanging energy with environment. Phase damping channel applies noise as: .. math:: \begin{gather*} \epsilon(\rho) = E_0 \rho E_0^\dagger + E_1 \rho E_1^\dagger \\ \text{where}\ {E_0}=\begin{bmatrix}1&0\\ 0&\sqrt{1-\gamma}\end{bmatrix}, \ {E_1}=\begin{bmatrix}0&0\\ 0&\sqrt{\gamma}\end{bmatrix} \end{gather*} where :math:`\rho` is quantum state as density matrix type; :math:`\gamma` is the coefficient of quantum information loss. Args: gamma (int, float): damping coefficient. Examples: >>> from mindquantum.core.gates import PhaseDampingChannel >>> from mindquantum.core.circuit import Circuit >>> circ = Circuit() >>> circ += PhaseDampingChannel(0.02).on(0) >>> print(circ) ╔═════════════╗ q0: ──╢ PDC(γ=1/50) ╟─── ╚═════════════╝ """ def __init__(self, gamma: float, **kwargs): """Initialize a PhaseDampingChannel object.""" kwargs['name'] = 'PDC' kwargs['n_qubits'] = 1 NoiseGate.__init__(self, **kwargs) NonHermitianGate.__init__(self, **kwargs) self.projectq_gate = None if not isinstance(gamma, (int, float)): raise TypeError(f"Unsupported type for gamma, get {type(gamma)}.") if 0 <= gamma <= 1: self.gamma = gamma else: raise ValueError("Required damping coefficient gamma ∈ [0,1].") def __eq__(self, other): """Equality comparison operator.""" return super().__eq__(other) and self.gamma == other.gamma def __type_specific_str__(self): """Return a string representation of the object.""" return f'γ={string_expression(self.gamma)}'
[文档] def get_cpp_obj(self): """Get underlying C++ object.""" return mb.gate.PhaseDampingChannel(self.gamma, self.obj_qubits, self.ctrl_qubits)
[文档] def define_projectq_gate(self): """Define the corresponded projectq gate.""" self.projectq_gate = None
[文档] def matrix(self): # pylint: disable=arguments-differ """ Kraus operator of the quantum channel. Returns: list, contains all Kraus operators of this quantum channel. """ mat_0 = np.array([[1, 0], [0, sqrt(1 - self.gamma)]]) mat_1 = np.array([[0, 0], [0, sqrt(self.gamma)]]) return [mat_0, mat_1]
[文档] class KrausChannel(NoiseGate, NonHermitianGate): r""" A kraus channel. Kraus channel accepts two or more 2x2 matrices as Kraus operator to construct custom (single-qubit) noise in quantum circuit. Kraus channel applies noise as: .. math:: \epsilon(\rho) = \sum_{k=0}^{m-1} E_k \rho E_k^\dagger where :math:`\rho` is quantum state as density matrix type; {:math:`E_k`} is Kraus operator, and it should satisfy the completeness condition: :math:`\sum_k E_k^\dagger E_k = I`. Args: name (str): the name of this custom noise channel. kraus_op (list, np.ndarray): Kraus operator, with two or more 2x2 matrices packaged as a list. Examples: >>> from mindquantum.core.gates import KrausChannel >>> from mindquantum.core.circuit import Circuit >>> from cmath import sqrt >>> gamma = 0.5 >>> kmat0 = [[1, 0], [0, sqrt(1 - gamma)]] >>> kmat1 = [[0, sqrt(gamma)], [0, 0]] >>> amplitude_damping = KrausChannel('damping', [kmat0, kmat1]) >>> circ = Circuit() >>> circ += amplitude_damping.on(0) >>> print(circ) ╔═════════╗ q0: ──╢ damping ╟─── ╚═════════╝ """ def __init__(self, name: str, kraus_op, **kwargs): """Initialize an KrausChannel object.""" _check_num_array(kraus_op, name) if not isinstance(kraus_op, np.ndarray): kraus_op = np.array(kraus_op) for mat in kraus_op: if len(mat.shape) != 2: raise ValueError(f"matrix_value require shape of 2, but get shape of {mat.shape}") if mat.shape[0] != mat.shape[1]: raise ValueError(f"matrix_value need a square matrix, but get shape {mat.shape}") if mat.shape[0] != 2: raise ValueError(f"Dimension of matrix_value need should be 2, but get {mat.shape[0]}") sum_of_mat = np.zeros((2, 2), 'complex128') for mat in kraus_op: sum_of_mat += np.dot(mat.T.conj(), mat) if not np.allclose(sum_of_mat, [[1, 0], [0, 1]], atol=1e-6): raise ValueError(f"kraus_op need to satisfy the completeness condition, but get {sum_of_mat}") kwargs['name'] = name kwargs['n_qubits'] = 1 NoiseGate.__init__(self, **kwargs) NonHermitianGate.__init__(self, **kwargs) self.projectq_gate = None self.kraus_op = kraus_op
[文档] def get_cpp_obj(self): """Get underlying C++ object.""" return mb.gate.KrausChannel(self.kraus_op, self.obj_qubits, self.ctrl_qubits)
[文档] def define_projectq_gate(self): """Define the corresponded projectq gate.""" self.projectq_gate = None
def __str_in_circ__(self): """Return a string representation of the object in a quantum circuit.""" return self.name
[文档] def matrix(self): # pylint: disable=arguments-differ """ Kraus operator of the quantum channel. Returns: list, contains all Kraus operators of this quantum channel. """ return list(self.kraus_op)
[文档] class ThermalRelaxationChannel(NoiseGate, NonHermitianGate): r""" Thermal relaxation channel. The thermal relaxation channel describes the thermal decoherence and dephasing of qubit when a quantum gate is applied, and is determined by T1, T2 and gate time. The Choi-matrix representation of this channel is as below: .. math:: \begin{gather*} \epsilon(\rho) = \text{tr}_1 \left[ \Lambda \left( \rho^T \otimes I \right) \right], \Lambda=\begin{pmatrix} \epsilon_{T_1} & 0 & 0 & \epsilon_{T_2} \\ 0 & 1-\epsilon_{T_1} & 0 & 0 \\ 0 & 0 & 0 & 0 \\ \epsilon_{T_2} & 0 & 0 & 1 \end{pmatrix} \\ \text{where}\ \epsilon_{T_1}=e^{-T_g/T_1}, \epsilon_{T_2}=e^{-T_g/T_2} \end{gather*} Where :math:`\rho` is quantum state as density matrix type; :math:`\Lambda` is Choi matrix, :math:`T_1` is thermal relaxation time of qubit, :math:`T_2` is dephasing time of qubit, :math:`T_g` is gate time. Args: t1 (int, float): T1 of the qubit. t2 (int, float): T2 of the qubit. gate_time (int, float): time of the quantum gate. Examples: >>> from mindquantum.core.gates import ThermalRelaxationChannel >>> from mindquantum.core.circuit import Circuit >>> t1 = 100000 >>> t2 = 50000 >>> gate_time = 35 >>> circ = Circuit() >>> circ += ThermalRelaxationChannel(t1, t2, gate_time).on(0) >>> print(circ) ╔═══════════════════════════════╗ q0: ──╢ TRC(t1=100000,t2=50000,tg=35) ╟─── ╚═══════════════════════════════╝ """ def __init__(self, t1: float, t2: float, gate_time: float, **kwargs): """Initialize a ThermalRelaxationChannel object.""" kwargs['name'] = 'TRC' kwargs['n_qubits'] = 1 NoiseGate.__init__(self, **kwargs) NonHermitianGate.__init__(self, **kwargs) self.projectq_gate = None if not isinstance(t1, (int, float)): raise TypeError(f"Unsupported type for t1, get {type(t1)}.") if not isinstance(t2, (int, float)): raise TypeError(f"Unsupported type for t2, get {type(t2)}.") if not isinstance(gate_time, (int, float)): raise TypeError(f"Unsupported type for gate_time, get {type(gate_time)}.") if (t1 <= 0) or (t2 <= 0): raise ValueError(f"T1 and T2 must be positive, but get T1={t1}, T2={t2}") if gate_time < 0: raise ValueError(f"gate time cannot be negative, but get {gate_time}") if t2 >= 2 * t1: raise ValueError("(T2 >= 2 * T1) is invalid case for thermal relaxation channel.") self.t1 = t1 self.t2 = t2 self.gate_time = gate_time
[文档] def get_cpp_obj(self): """Get underlying C++ object.""" return mb.gate.ThermalRelaxationChannel(self.t1, self.t2, self.gate_time, self.obj_qubits, self.ctrl_qubits)
def __type_specific_str__(self): """Return a string representation of the object.""" return f't1={string_expression(self.t1)},t2={string_expression(self.t2)},tg={string_expression(self.gate_time)}'
[文档] def matrix(self): # pylint: disable=arguments-differ,too-many-locals """ Kraus operator of the quantum channel. Returns: list, contains all Kraus operators of this quantum channel. """ e1 = exp(-self.gate_time / self.t1) e2 = exp(-self.gate_time / self.t2) p_reset = 1 - e1 if self.t1 >= self.t2: pz = e1 * (1 - e2 / e1) / 2 ki = np.array([[sqrt(1 - pz - p_reset), 0], [0, sqrt(1 - pz - p_reset)]]) kz = np.array([[sqrt(pz), 0], [0, -sqrt(pz)]]) k_reset00 = np.array([[sqrt(p_reset), 0], [0, 0]]) k_reset01 = np.array([[0, sqrt(p_reset)], [0, 0]]) return [ki, kz, k_reset00, k_reset01] if 2 * self.t1 > self.t2: eigenvalue0 = (2 - p_reset + sqrt(p_reset**2 + 4 * e2**2)) / 2 eigenvalue1 = (2 - p_reset - sqrt(p_reset**2 + 4 * e2**2)) / 2 eigen_vector0 = (eigenvalue0 - e1) / e2 eigen_vector1 = (eigenvalue1 - e1) / e2 k0 = np.array([[eigen_vector0, 0], [0, 1]]) * sqrt(eigenvalue0 / (eigen_vector0**2 + 1)) k1 = np.array([[eigen_vector1, 0], [0, 1]]) * sqrt(eigenvalue1 / (eigen_vector1**2 + 1)) k2 = np.array([[0, sqrt(p_reset)], [0, 0]]) return [k0, k1, k2] raise ValueError("(T2 >= 2 * T1) is invalid case for thermal relaxation channel.")